CAS 1250249-33-2 is the registry number for Ethyl 3-(3-fluoro-4-methylphenyl)-3-oxopropanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl 3-(3-fluoro-4-methylphenyl)-3-oxopropanoate (CAS 1250249-33-2) is a chemical compound with the molecular formula C12H13FO3 and a molecular weight of 224.23 g/mol. IUPAC name: ethyl 3-(3-fluoro-4-methylphenyl)-3-oxopropanoate. InChIKey: FKXSDCFCHUAAEN-UHFFFAOYSA-N.
| Molecular formula | C12H13FO3 |
|---|---|
| Molecular weight | 224.23 g/mol |
| IUPAC name | ethyl 3-(3-fluoro-4-methylphenyl)-3-oxopropanoate |
| InChIKey | FKXSDCFCHUAAEN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C1=CC(=C(C=C1)C)F |
Computed by PubChem (NCBI)