Products 1249274-33-6
CAS 1249274-33-6 is the registry number for 1-(3,4-Dichlorophenyl)piperidin-3-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(3,4-dichlorophenyl)piperidin-3-amine (CAS 1249274-33-6) is a chemical compound with the molecular formula C11H14Cl2N2 and a molecular weight of 245.14 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)piperidin-3-amine. InChIKey: NJLRPQXEJMDNFX-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl2N2 |
|---|---|
| Molecular weight | 245.14 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)piperidin-3-amine |
| InChIKey | NJLRPQXEJMDNFX-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C2=CC(=C(C=C2)Cl)Cl)N |
Computed by PubChem (NCBI)