Products 1249387-13-0

CAS 1249387-13-0 appears in our catalog under these names: (5-Nitrothiophen-3-yl)methanesulfonyl chloride, 95%, (5-Nitrothiophen-3-yl)methanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

(5-nitrothiophen-3-yl)methanesulfonyl chloride (CAS 1249387-13-0) is a chemical compound with the molecular formula C5H4ClNO4S2 and a molecular weight of 241.7 g/mol. IUPAC name: (5-nitrothiophen-3-yl)methanesulfonyl chloride. InChIKey: BPZJGMOZICSUTC-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4ClNO4S2
Molecular weight241.7 g/mol
IUPAC name(5-nitrothiophen-3-yl)methanesulfonyl chloride
InChIKeyBPZJGMOZICSUTC-UHFFFAOYSA-N
SMILESC1=C(SC=C1CS(=O)(=O)Cl)[N+](=O)[O-]

Computed by PubChem (NCBI)