CAS 89502-07-8 is the registry number for Methyl 5-(chlorosulfonyl)thiazole-4-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
Methyl 5-chlorosulfonyl-1,3-thiazole-4-carboxylate (CAS 89502-07-8) is a chemical compound with the molecular formula C5H4ClNO4S2 and a molecular weight of 241.7 g/mol. IUPAC name: methyl 5-chlorosulfonyl-1,3-thiazole-4-carboxylate. InChIKey: MUCZBASPBXHGJA-UHFFFAOYSA-N.
| Molecular formula | C5H4ClNO4S2 |
|---|---|
| Molecular weight | 241.7 g/mol |
| IUPAC name | methyl 5-chlorosulfonyl-1,3-thiazole-4-carboxylate |
| InChIKey | MUCZBASPBXHGJA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(SC=N1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)