CAS 2931875-68-0 is the registry number for Methyl 5-(chlorosulfonyl)thiazole-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-chlorosulfonyl-1,3-thiazole-2-carboxylate (CAS 2931875-68-0) is a chemical compound with the molecular formula C5H4ClNO4S2 and a molecular weight of 241.7 g/mol. IUPAC name: methyl 5-chlorosulfonyl-1,3-thiazole-2-carboxylate. InChIKey: VTLXQMURCJEAKM-UHFFFAOYSA-N.
| Molecular formula | C5H4ClNO4S2 |
|---|---|
| Molecular weight | 241.7 g/mol |
| IUPAC name | methyl 5-chlorosulfonyl-1,3-thiazole-2-carboxylate |
| InChIKey | VTLXQMURCJEAKM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC=C(S1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)