CAS 89502-21-6 appears in our catalog under these names: Methyl 4-(chlorosulfonyl)-1,2-thiazole-3-carboxylate, 95%, Methyl 4-(chlorosulfonyl)-1,2-thiazole-3-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl 4-chlorosulfonyl-1,2-thiazole-3-carboxylate (CAS 89502-21-6) is a chemical compound with the molecular formula C5H4ClNO4S2 and a molecular weight of 241.7 g/mol. IUPAC name: methyl 4-chlorosulfonyl-1,2-thiazole-3-carboxylate. InChIKey: WYKYCPZIJDWNPV-UHFFFAOYSA-N.
| Molecular formula | C5H4ClNO4S2 |
|---|---|
| Molecular weight | 241.7 g/mol |
| IUPAC name | methyl 4-chlorosulfonyl-1,2-thiazole-3-carboxylate |
| InChIKey | WYKYCPZIJDWNPV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NSC=C1S(=O)(=O)Cl |
Computed by PubChem (NCBI)