CAS 1249412-18-7 is the registry number for 1-(Pyridin-2-ylmethyl)-1H-1,2,4-triazole-3-carbonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(pyridin-2-ylmethyl)-1,2,4-triazole-3-carbonitrile (CAS 1249412-18-7) is a chemical compound with the molecular formula C9H7N5 and a molecular weight of 185.19 g/mol. IUPAC name: 1-(pyridin-2-ylmethyl)-1,2,4-triazole-3-carbonitrile. InChIKey: DKIHBNQZSAXIMV-UHFFFAOYSA-N.
| Molecular formula | C9H7N5 |
|---|---|
| Molecular weight | 185.19 g/mol |
| IUPAC name | 1-(pyridin-2-ylmethyl)-1,2,4-triazole-3-carbonitrile |
| InChIKey | DKIHBNQZSAXIMV-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)CN2C=NC(=N2)C#N |
Computed by PubChem (NCBI)