CAS 76278-98-3 is the registry number for Benzo[4,5]imidazo[1,2-a][1,3,5]triazin-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[1,3,5]triazino[1,2-a]benzimidazol-4-amine (CAS 76278-98-3) is a chemical compound with the molecular formula C9H7N5 and a molecular weight of 185.19 g/mol. IUPAC name: [1,3,5]triazino[1,2-a]benzimidazol-4-amine. InChIKey: OTDQOKVNUPSUAI-UHFFFAOYSA-N.
| Molecular formula | C9H7N5 |
|---|---|
| Molecular weight | 185.19 g/mol |
| IUPAC name | [1,3,5]triazino[1,2-a]benzimidazol-4-amine |
| InChIKey | OTDQOKVNUPSUAI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C3N2C(=NC=N3)N |
Computed by PubChem (NCBI)