CAS 20271-39-0 is the registry number for 5-Amino-1-phenyl-1H-1,2,3-triazole-4-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-amino-1-phenyltriazole-4-carbonitrile (CAS 20271-39-0) is a chemical compound with the molecular formula C9H7N5 and a molecular weight of 185.19 g/mol. IUPAC name: 5-amino-1-phenyltriazole-4-carbonitrile. InChIKey: TVTIMSZZFVIKDM-UHFFFAOYSA-N.
| Molecular formula | C9H7N5 |
|---|---|
| Molecular weight | 185.19 g/mol |
| IUPAC name | 5-amino-1-phenyltriazole-4-carbonitrile |
| InChIKey | TVTIMSZZFVIKDM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=C(N=N2)C#N)N |
Computed by PubChem (NCBI)