CAS 36047-75-3 is the registry number for 5H-1,2,4-Triazino[5,6-b]indol-3-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5H-[1,2,4]triazino[5,6-b]indol-3-amine (CAS 36047-75-3) is a chemical compound with the molecular formula C9H7N5 and a molecular weight of 185.19 g/mol. IUPAC name: 5H-[1,2,4]triazino[5,6-b]indol-3-amine. InChIKey: ASGZIQFYJJFISO-UHFFFAOYSA-N.
| Molecular formula | C9H7N5 |
|---|---|
| Molecular weight | 185.19 g/mol |
| IUPAC name | 5H-[1,2,4]triazino[5,6-b]indol-3-amine |
| InChIKey | ASGZIQFYJJFISO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)N=C(N=N3)N |
Computed by PubChem (NCBI)