CAS 1249449-54-4 is the registry number for 2-(5,6-Dimethyl-1H-1,3-benzodiazol-1-yl)propanethioamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(5,6-dimethylbenzimidazol-1-yl)propanethioamide (CAS 1249449-54-4) is a chemical compound with the molecular formula C12H15N3S and a molecular weight of 233.33 g/mol. IUPAC name: 2-(5,6-dimethylbenzimidazol-1-yl)propanethioamide. InChIKey: XEJNPKJANPPDCF-UHFFFAOYSA-N.
| Molecular formula | C12H15N3S |
|---|---|
| Molecular weight | 233.33 g/mol |
| IUPAC name | 2-(5,6-dimethylbenzimidazol-1-yl)propanethioamide |
| InChIKey | XEJNPKJANPPDCF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)N(C=N2)C(C)C(=S)N |
Computed by PubChem (NCBI)