Products 1249477-24-4
CAS 1249477-24-4 is the registry number for 6-Ethyl-2-oxo-1,2,5,6,7,8-hexahydroquinoline-3-carboxylic acid, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
6-ethyl-2-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carboxylic acid (CAS 1249477-24-4) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 221.25 g/mol. IUPAC name: 6-ethyl-2-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carboxylic acid. InChIKey: TXWUFMDSIXFBPI-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3 |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | 6-ethyl-2-oxo-5,6,7,8-tetrahydro-1H-quinoline-3-carboxylic acid |
| InChIKey | TXWUFMDSIXFBPI-UHFFFAOYSA-N |
| SMILES | CCC1CCC2=C(C1)C=C(C(=O)N2)C(=O)O |
Computed by PubChem (NCBI)