Products 1249616-03-2

CAS 1249616-03-2 is the registry number for Methyl 2-chloro-2-(3-fluorophenyl)acetate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 2-chloro-2-(3-fluorophenyl)acetate (CAS 1249616-03-2) is a chemical compound with the molecular formula C9H8ClFO2 and a molecular weight of 202.61 g/mol. IUPAC name: methyl 2-chloro-2-(3-fluorophenyl)acetate. InChIKey: LRGZIEJDQLKLCK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8ClFO2
Molecular weight202.61 g/mol
IUPAC namemethyl 2-chloro-2-(3-fluorophenyl)acetate
InChIKeyLRGZIEJDQLKLCK-UHFFFAOYSA-N
SMILESCOC(=O)C(C1=CC(=CC=C1)F)Cl

Computed by PubChem (NCBI)