CAS 1249747-32-7 appears in our catalog under these names: 5-Bromo-2-(2,2,2-trifluoroethoxy)pyridin-3-amine, 95%, 5-Bromo-2-(2,2,2-trifluoroethoxy)pyridin-3-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
5-bromo-2-(2,2,2-trifluoroethoxy)pyridin-3-amine (CAS 1249747-32-7) is a chemical compound with the molecular formula C7H6BrF3N2O and a molecular weight of 271.03 g/mol. IUPAC name: 5-bromo-2-(2,2,2-trifluoroethoxy)pyridin-3-amine. InChIKey: YDDYTXBWSWSPDK-UHFFFAOYSA-N.
| Molecular formula | C7H6BrF3N2O |
|---|---|
| Molecular weight | 271.03 g/mol |
| IUPAC name | 5-bromo-2-(2,2,2-trifluoroethoxy)pyridin-3-amine |
| InChIKey | YDDYTXBWSWSPDK-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1N)OCC(F)(F)F)Br |
Computed by PubChem (NCBI)