Products 2379241-99-1
CAS 2379241-99-1 is the registry number for 3-Bromo-2-(trifluoromethyl)-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-2-(trifluoromethyl)-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazine (CAS 2379241-99-1) is a chemical compound with the molecular formula C7H6BrF3N2O and a molecular weight of 271.03 g/mol. IUPAC name: 3-bromo-2-(trifluoromethyl)-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazine. InChIKey: LCKBNGULLVCHHV-UHFFFAOYSA-N.
| Molecular formula | C7H6BrF3N2O |
|---|---|
| Molecular weight | 271.03 g/mol |
| IUPAC name | 3-bromo-2-(trifluoromethyl)-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazine |
| InChIKey | LCKBNGULLVCHHV-UHFFFAOYSA-N |
| SMILES | C1COCC2=C(C(=NN21)C(F)(F)F)Br |
Computed by PubChem (NCBI)