Products 1373233-29-4
CAS 1373233-29-4 is the registry number for 4-Bromo-6-(trifluoromethoxy)benzene-1,3-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-bromo-6-(trifluoromethoxy)benzene-1,3-diamine (CAS 1373233-29-4) is a chemical compound with the molecular formula C7H6BrF3N2O and a molecular weight of 271.03 g/mol. IUPAC name: 4-bromo-6-(trifluoromethoxy)benzene-1,3-diamine. InChIKey: IQJMAGSDYJEEBS-UHFFFAOYSA-N.
| Molecular formula | C7H6BrF3N2O |
|---|---|
| Molecular weight | 271.03 g/mol |
| IUPAC name | 4-bromo-6-(trifluoromethoxy)benzene-1,3-diamine |
| InChIKey | IQJMAGSDYJEEBS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1N)Br)OC(F)(F)F)N |
Computed by PubChem (NCBI)