CAS 156425-07-9 is the registry number for 4-Bromo-5-(trifluoromethoxy)-1,2-phenylenediamine, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-bromo-5-(trifluoromethoxy)benzene-1,2-diamine (CAS 156425-07-9) is a chemical compound with the molecular formula C7H6BrF3N2O and a molecular weight of 271.03 g/mol. IUPAC name: 4-bromo-5-(trifluoromethoxy)benzene-1,2-diamine. InChIKey: KGYPCBHVYVIFFM-UHFFFAOYSA-N.
| Molecular formula | C7H6BrF3N2O |
|---|---|
| Molecular weight | 271.03 g/mol |
| IUPAC name | 4-bromo-5-(trifluoromethoxy)benzene-1,2-diamine |
| InChIKey | KGYPCBHVYVIFFM-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1OC(F)(F)F)Br)N)N |
Computed by PubChem (NCBI)