CAS 124980-93-4 appears in our catalog under these names: (S)–3–(4–Fluorophenyl)–2–hydroxypropionic Acid, (S)-3-(4-Fluorophenyl)-2-hydroxypropionic Acid 95%, (S)-3-(4-fluorophenyl)-2-hydroxypropanoic acid, 95%, (S)-3-(4-Fluorophenyl)-2-Hydroxypropionic Acid, 95%, 95%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2S)-3-(4-fluorophenyl)-2-hydroxypropanoic acid (CAS 124980-93-4) is a chemical compound with the molecular formula C9H9FO3 and a molecular weight of 184.16 g/mol. IUPAC name: (2S)-3-(4-fluorophenyl)-2-hydroxypropanoic acid. InChIKey: YZDVNWXOYGTHJO-QMMMGPOBSA-N.
| Molecular formula | C9H9FO3 |
|---|---|
| Molecular weight | 184.16 g/mol |
| IUPAC name | (2S)-3-(4-fluorophenyl)-2-hydroxypropanoic acid |
| InChIKey | YZDVNWXOYGTHJO-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](C(=O)O)O)F |
Computed by PubChem (NCBI)