CAS 1249929-52-9 appears in our catalog under these names: 1-(3-Bromo-4-methoxyphenyl)-2,2,2-trifluoroethan-1-ol, 1-(3-Bromo-4-methoxyphenyl)-2,2,2-trifluoroethan-1-ol, 95%, 95%, 1-(3-Bromo-4-methoxyphenyl)-2,2,2-trifluoroethan-1-ol, 95%, 1-(3-Bromo-4-methoxyphenyl)-2,2,2-trifluoroethan-1-ol, 97%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 2,5g, 100mg, 1g, 5g, 50mg, 500mg, 2.5g.
1-(3-bromo-4-methoxyphenyl)-2,2,2-trifluoroethanol (CAS 1249929-52-9) is a chemical compound with the molecular formula C9H8BrF3O2 and a molecular weight of 285.06 g/mol. IUPAC name: 1-(3-bromo-4-methoxyphenyl)-2,2,2-trifluoroethanol. InChIKey: JKZPYJJPAHZBFZ-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF3O2 |
|---|---|
| Molecular weight | 285.06 g/mol |
| IUPAC name | 1-(3-bromo-4-methoxyphenyl)-2,2,2-trifluoroethanol |
| InChIKey | JKZPYJJPAHZBFZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(C(F)(F)F)O)Br |
Computed by PubChem (NCBI)