CAS 1461689-30-4 appears in our catalog under these names: (1S)-1-(3-Bromo-4-methoxyphenyl)-2,2,2-trifluoroethan-1-ol, 95%, (1S)-1-(3-Bromo-4-methoxyphenyl)-2,2,2-trifluoroethan-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(1S)-1-(3-bromo-4-methoxyphenyl)-2,2,2-trifluoroethanol (CAS 1461689-30-4) is a chemical compound with the molecular formula C9H8BrF3O2 and a molecular weight of 285.06 g/mol. IUPAC name: (1S)-1-(3-bromo-4-methoxyphenyl)-2,2,2-trifluoroethanol. InChIKey: JKZPYJJPAHZBFZ-QMMMGPOBSA-N.
| Molecular formula | C9H8BrF3O2 |
|---|---|
| Molecular weight | 285.06 g/mol |
| IUPAC name | (1S)-1-(3-bromo-4-methoxyphenyl)-2,2,2-trifluoroethanol |
| InChIKey | JKZPYJJPAHZBFZ-QMMMGPOBSA-N |
| SMILES | COC1=C(C=C(C=C1)[C@@H](C(F)(F)F)O)Br |
Computed by PubChem (NCBI)