Products 1249939-76-1
CAS 1249939-76-1 is the registry number for 4-(3-(Propan-2-yl)-1H-pyrazol-1-yl)benzaldehyde. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(3-propan-2-ylpyrazol-1-yl)benzaldehyde (CAS 1249939-76-1) is a chemical compound with the molecular formula C13H14N2O and a molecular weight of 214.26 g/mol. IUPAC name: 4-(3-propan-2-ylpyrazol-1-yl)benzaldehyde. InChIKey: KNNGMTYDZDERFE-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | 4-(3-propan-2-ylpyrazol-1-yl)benzaldehyde |
| InChIKey | KNNGMTYDZDERFE-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NN(C=C1)C2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)