CAS 1250005-39-0 is the registry number for 3-((Benzenesulfinyl)methyl)aniline. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-(benzenesulfinylmethyl)aniline (CAS 1250005-39-0) is a chemical compound with the molecular formula C13H13NOS and a molecular weight of 231.32 g/mol. IUPAC name: 3-(benzenesulfinylmethyl)aniline. InChIKey: ZCCRONCNAAMYNN-UHFFFAOYSA-N.
| Molecular formula | C13H13NOS |
|---|---|
| Molecular weight | 231.32 g/mol |
| IUPAC name | 3-(benzenesulfinylmethyl)aniline |
| InChIKey | ZCCRONCNAAMYNN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)CC2=CC(=CC=C2)N |
Computed by PubChem (NCBI)