Products 1250149-37-1
CAS 1250149-37-1 is the registry number for 2-(5-(Trifluoromethyl)-1,2,4-oxadiazol-3-yl)aniline, 95%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg.
2-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]aniline (CAS 1250149-37-1) is a chemical compound with the molecular formula C9H6F3N3O and a molecular weight of 229.16 g/mol. IUPAC name: 2-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]aniline. InChIKey: XRHQTHVKEYOGBJ-UHFFFAOYSA-N.
| Molecular formula | C9H6F3N3O |
|---|---|
| Molecular weight | 229.16 g/mol |
| IUPAC name | 2-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]aniline |
| InChIKey | XRHQTHVKEYOGBJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NOC(=N2)C(F)(F)F)N |
Computed by PubChem (NCBI)