CAS 1197229-53-0 appears in our catalog under these names: 3-(5-Trifluoromethyl-[1,3,4]oxadiazol-2-yl)-phenylamine, 98%, 3-(5-(Trifluoromethyl)-1,3,4-oxadiazol-2-yl)aniline, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
3-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]aniline (CAS 1197229-53-0) is a chemical compound with the molecular formula C9H6F3N3O and a molecular weight of 229.16 g/mol. IUPAC name: 3-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]aniline. InChIKey: UPLZFZHUNUYGBX-UHFFFAOYSA-N.
| Molecular formula | C9H6F3N3O |
|---|---|
| Molecular weight | 229.16 g/mol |
| IUPAC name | 3-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]aniline |
| InChIKey | UPLZFZHUNUYGBX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=NN=C(O2)C(F)(F)F |
Computed by PubChem (NCBI)