CAS 1823496-56-5 is the registry number for 2-Methyl-3-(1,3,4-oxadiazol-2-yl)-6-(trifluoromethyl)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-[2-methyl-6-(trifluoromethyl)-3-pyridinyl]-1,3,4-oxadiazole (CAS 1823496-56-5) is a chemical compound with the molecular formula C9H6F3N3O and a molecular weight of 229.16 g/mol. IUPAC name: 2-[2-methyl-6-(trifluoromethyl)-3-pyridinyl]-1,3,4-oxadiazole. InChIKey: WEAQPGABMCTUKP-UHFFFAOYSA-N.
| Molecular formula | C9H6F3N3O |
|---|---|
| Molecular weight | 229.16 g/mol |
| IUPAC name | 2-[2-methyl-6-(trifluoromethyl)-3-pyridinyl]-1,3,4-oxadiazole |
| InChIKey | WEAQPGABMCTUKP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=N1)C(F)(F)F)C2=NN=CO2 |
Computed by PubChem (NCBI)