Products 50440-86-3
CAS 50440-86-3 is the registry number for 4(3H)-Quinazolinone, 2-amino-7-(trifluoromethyl)-, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-amino-7-(trifluoromethyl)-3H-quinazolin-4-one (CAS 50440-86-3) is a chemical compound with the molecular formula C9H6F3N3O and a molecular weight of 229.16 g/mol. IUPAC name: 2-amino-7-(trifluoromethyl)-3H-quinazolin-4-one. InChIKey: YKRJERFQSDIWPH-UHFFFAOYSA-N.
| Molecular formula | C9H6F3N3O |
|---|---|
| Molecular weight | 229.16 g/mol |
| IUPAC name | 2-amino-7-(trifluoromethyl)-3H-quinazolin-4-one |
| InChIKey | YKRJERFQSDIWPH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)N=C(NC2=O)N |
Computed by PubChem (NCBI)