CAS 910442-24-9 appears in our catalog under these names: 3-(3-(Trifluoromethyl)phenyl)-1,2,4-oxadiazol-5-amine, 97%, 3–(3–(Trifluoromethyl)phenyl)–1,2,4–oxadiazol–5–amine, 3-(3-(Trifluoromethyl)phenyl)-1,2,4-oxadiazol-5-amine, 98%, 98%, 3-(3-(TRIFLUOROMETHYL)PHENYL)-1,2,4-OXADIAZOL-5-AMINE, 98%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 50mg, 100mg.
3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-amine (CAS 910442-24-9) is a chemical compound with the molecular formula C9H6F3N3O and a molecular weight of 229.16 g/mol. IUPAC name: 3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-amine. InChIKey: MDOPZJDBIFNDGS-UHFFFAOYSA-N.
| Molecular formula | C9H6F3N3O |
|---|---|
| Molecular weight | 229.16 g/mol |
| IUPAC name | 3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-amine |
| InChIKey | MDOPZJDBIFNDGS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C2=NOC(=N2)N |
Computed by PubChem (NCBI)