CAS 125036-88-6 appears in our catalog under these names: 4-(Benzyloxy)-3,5-difluorobenzaldehyde, 95%, 4-(Benzyloxy)-3,5-difluorobenzaldehyde, 97%, 4-(Benzyloxy)-3,5-difluorobenzaldehyde. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
3,5-difluoro-4-phenylmethoxybenzaldehyde (CAS 125036-88-6) is a chemical compound with the molecular formula C14H10F2O2 and a molecular weight of 248.22 g/mol. IUPAC name: 3,5-difluoro-4-phenylmethoxybenzaldehyde. InChIKey: QKRBYGWUSGMSLG-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O2 |
|---|---|
| Molecular weight | 248.22 g/mol |
| IUPAC name | 3,5-difluoro-4-phenylmethoxybenzaldehyde |
| InChIKey | QKRBYGWUSGMSLG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2F)C=O)F |
Computed by PubChem (NCBI)