CAS 866108-76-1 appears in our catalog under these names: 3-Biphenyl-3',4'-difluoro-acetic acid, 95%, 2-(3',4'-Difluoro-(1,1'-biphenyl)-3-yl)acetic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2-[3-(3,4-difluorophenyl)phenyl]acetic acid (CAS 866108-76-1) is a chemical compound with the molecular formula C14H10F2O2 and a molecular weight of 248.22 g/mol. IUPAC name: 2-[3-(3,4-difluorophenyl)phenyl]acetic acid. InChIKey: LNCISQVUJFQGMA-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O2 |
|---|---|
| Molecular weight | 248.22 g/mol |
| IUPAC name | 2-[3-(3,4-difluorophenyl)phenyl]acetic acid |
| InChIKey | LNCISQVUJFQGMA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC(=C(C=C2)F)F)CC(=O)O |
Computed by PubChem (NCBI)