CAS 1820706-66-8 is the registry number for methyl 3-(2,4-difluorophenyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 3-(2,4-difluorophenyl)benzoate (CAS 1820706-66-8) is a chemical compound with the molecular formula C14H10F2O2 and a molecular weight of 248.22 g/mol. IUPAC name: methyl 3-(2,4-difluorophenyl)benzoate. InChIKey: XJVMJGBCFNHQRL-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O2 |
|---|---|
| Molecular weight | 248.22 g/mol |
| IUPAC name | methyl 3-(2,4-difluorophenyl)benzoate |
| InChIKey | XJVMJGBCFNHQRL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)