CAS 53458-16-5 appears in our catalog under these names: 4,4'-Difluorobenzoin, 95%, 1,2–Bis(4–fluorophenyl)–2–hydroxyethanone, 1,2-Bis(4-fluorophenyl)-2-hydroxyethanone 98%, 1,2-Bis(4-fluorophenyl)-2-hydroxyethanone, 98%, 98%, 1,2-Bis(4-fluorophenyl)-2-hydroxyethanone, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 10g, 5g, 1g.
1,2-bis(4-fluorophenyl)-2-hydroxyethanone (CAS 53458-16-5) is a chemical compound with the molecular formula C14H10F2O2 and a molecular weight of 248.22 g/mol. IUPAC name: 1,2-bis(4-fluorophenyl)-2-hydroxyethanone. InChIKey: VGZHWXAFILGMSR-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O2 |
|---|---|
| Molecular weight | 248.22 g/mol |
| IUPAC name | 1,2-bis(4-fluorophenyl)-2-hydroxyethanone |
| InChIKey | VGZHWXAFILGMSR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(=O)C2=CC=C(C=C2)F)O)F |
Computed by PubChem (NCBI)