CAS 1250373-97-7 appears in our catalog under these names: 2-Chloro-N-isopropyl-N,6-dimethylpyrimidin-4-amine, 95%, 2-Chloro-N,6-dimethyl-N-(propan-2-yl)pyrimidin-4-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-chloro-N,6-dimethyl-N-propan-2-ylpyrimidin-4-amine (CAS 1250373-97-7) is a chemical compound with the molecular formula C9H14ClN3 and a molecular weight of 199.68 g/mol. IUPAC name: 2-chloro-N,6-dimethyl-N-propan-2-ylpyrimidin-4-amine. InChIKey: PMBHDVWMJSUXPY-UHFFFAOYSA-N.
| Molecular formula | C9H14ClN3 |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | 2-chloro-N,6-dimethyl-N-propan-2-ylpyrimidin-4-amine |
| InChIKey | PMBHDVWMJSUXPY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)Cl)N(C)C(C)C |
Computed by PubChem (NCBI)