Products 14317-41-0

CAS 14317-41-0 is the registry number for N-(1-Phenylethyl)guanidine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-(1-phenylethyl)guanidine;hydrochloride (CAS 14317-41-0) is a chemical compound with the molecular formula C9H14ClN3 and a molecular weight of 199.68 g/mol. IUPAC name: 2-(1-phenylethyl)guanidine;hydrochloride. InChIKey: XCEVGQBJVMVXTJ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H14ClN3
Molecular weight199.68 g/mol
IUPAC name2-(1-phenylethyl)guanidine;hydrochloride
InChIKeyXCEVGQBJVMVXTJ-UHFFFAOYSA-N
SMILESCC(C1=CC=CC=C1)N=C(N)N.Cl

Computed by PubChem (NCBI)