CAS 180507-22-6 is the registry number for 4-(Dimethylamino)benzimidamide hydrochloride, 95+%. Offered by: AmBeed. Available pack sizes: 10g.
4-(dimethylamino)benzenecarboximidamide;hydrochloride (CAS 180507-22-6) is a chemical compound with the molecular formula C9H14ClN3 and a molecular weight of 199.68 g/mol. IUPAC name: 4-(dimethylamino)benzenecarboximidamide;hydrochloride. InChIKey: MIUFWHOMWWNKFK-UHFFFAOYSA-N.
| Molecular formula | C9H14ClN3 |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | 4-(dimethylamino)benzenecarboximidamide;hydrochloride |
| InChIKey | MIUFWHOMWWNKFK-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C(=N)N.Cl |
Computed by PubChem (NCBI)