CAS 2235-99-6 is the registry number for 1-Phenethylguanidine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(2-phenylethyl)guanidine;hydrochloride (CAS 2235-99-6) is a chemical compound with the molecular formula C9H14ClN3 and a molecular weight of 199.68 g/mol. IUPAC name: 2-(2-phenylethyl)guanidine;hydrochloride. InChIKey: AWWYTNWPJVYYMH-UHFFFAOYSA-N.
| Molecular formula | C9H14ClN3 |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | 2-(2-phenylethyl)guanidine;hydrochloride |
| InChIKey | AWWYTNWPJVYYMH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCN=C(N)N.Cl |
Computed by PubChem (NCBI)