CAS 1250443-81-2 appears in our catalog under these names: Methyl 1-chloro-2,7-naphthyridine-3-carboxylate, 97%, Methyl 1-chloro-2,7-naphthyridine-3-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl 1-chloro-2,7-naphthyridine-3-carboxylate (CAS 1250443-81-2) is a chemical compound with the molecular formula C10H7ClN2O2 and a molecular weight of 222.63 g/mol. IUPAC name: methyl 1-chloro-2,7-naphthyridine-3-carboxylate. InChIKey: MPTLYZXPSWAJOZ-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O2 |
|---|---|
| Molecular weight | 222.63 g/mol |
| IUPAC name | methyl 1-chloro-2,7-naphthyridine-3-carboxylate |
| InChIKey | MPTLYZXPSWAJOZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC(=C2C=NC=CC2=C1)Cl |
Computed by PubChem (NCBI)