Products 1250541-35-5
CAS 1250541-35-5 is the registry number for 3-tert-Butyl-(1,2,4)triazolo(4,3-a)pyridine-6-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-tert-butyl-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid (CAS 1250541-35-5) is a chemical compound with the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. IUPAC name: 3-tert-butyl-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid. InChIKey: PSOVSGGWCPIFAD-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O2 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 3-tert-butyl-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid |
| InChIKey | PSOVSGGWCPIFAD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN=C2N1C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)