Products 1250558-73-6
CAS 1250558-73-6 is the registry number for 4-((3-Bromophenyl)methyl)morpholine-3,5-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-[(3-bromophenyl)methyl]morpholine-3,5-dione (CAS 1250558-73-6) is a chemical compound with the molecular formula C11H10BrNO3 and a molecular weight of 284.11 g/mol. IUPAC name: 4-[(3-bromophenyl)methyl]morpholine-3,5-dione. InChIKey: JLCSUPHQXMNQOJ-UHFFFAOYSA-N.
| Molecular formula | C11H10BrNO3 |
|---|---|
| Molecular weight | 284.11 g/mol |
| IUPAC name | 4-[(3-bromophenyl)methyl]morpholine-3,5-dione |
| InChIKey | JLCSUPHQXMNQOJ-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=O)CO1)CC2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)