CAS 125058-21-1 appears in our catalog under these names: 2-(Bromomethyl)imidazo[1,2-a]pyrimidine hydrobromide, 95%, 2-(Bromomethyl)imidazo(1,2-a)pyrimidine hydrobromide, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 25g, 250mg, 1g.
2-(bromomethyl)imidazo[1,2-a]pyrimidine;hydrobromide (CAS 125058-21-1) is a chemical compound with the molecular formula C7H7Br2N3 and a molecular weight of 292.96 g/mol. IUPAC name: 2-(bromomethyl)imidazo[1,2-a]pyrimidine;hydrobromide. InChIKey: DTLYXYQHZUVZFJ-UHFFFAOYSA-N.
| Molecular formula | C7H7Br2N3 |
|---|---|
| Molecular weight | 292.96 g/mol |
| IUPAC name | 2-(bromomethyl)imidazo[1,2-a]pyrimidine;hydrobromide |
| InChIKey | DTLYXYQHZUVZFJ-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(N=C2N=C1)CBr.Br |
Computed by PubChem (NCBI)