CAS 74861-87-3 is the registry number for 1-(2,6-Dibromophenyl)guanidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,6-dibromophenyl)guanidine (CAS 74861-87-3) is a chemical compound with the molecular formula C7H7Br2N3 and a molecular weight of 292.96 g/mol. IUPAC name: 2-(2,6-dibromophenyl)guanidine. InChIKey: FGAAXJPCMRYXTE-UHFFFAOYSA-N.
| Molecular formula | C7H7Br2N3 |
|---|---|
| Molecular weight | 292.96 g/mol |
| IUPAC name | 2-(2,6-dibromophenyl)guanidine |
| InChIKey | FGAAXJPCMRYXTE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)N=C(N)N)Br |
Computed by PubChem (NCBI)