CAS 2309457-98-3 is the registry number for 6-Bromo-2-methylimidazo[1,2-a]pyrazine hydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg, 100mg.
6-bromo-2-methylimidazo[1,2-a]pyrazine;hydrobromide (CAS 2309457-98-3) is a chemical compound with the molecular formula C7H7Br2N3 and a molecular weight of 292.96 g/mol. IUPAC name: 6-bromo-2-methylimidazo[1,2-a]pyrazine;hydrobromide. InChIKey: BMTKBNISKGKYPI-UHFFFAOYSA-N.
| Molecular formula | C7H7Br2N3 |
|---|---|
| Molecular weight | 292.96 g/mol |
| IUPAC name | 6-bromo-2-methylimidazo[1,2-a]pyrazine;hydrobromide |
| InChIKey | BMTKBNISKGKYPI-UHFFFAOYSA-N |
| SMILES | CC1=CN2C=C(N=CC2=N1)Br.Br |
Computed by PubChem (NCBI)