Products 2309457-98-3

CAS 2309457-98-3 is the registry number for 6-Bromo-2-methylimidazo[1,2-a]pyrazine hydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

6-bromo-2-methylimidazo[1,2-a]pyrazine;hydrobromide (CAS 2309457-98-3) is a chemical compound with the molecular formula C7H7Br2N3 and a molecular weight of 292.96 g/mol. IUPAC name: 6-bromo-2-methylimidazo[1,2-a]pyrazine;hydrobromide. InChIKey: BMTKBNISKGKYPI-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7Br2N3
Molecular weight292.96 g/mol
IUPAC name6-bromo-2-methylimidazo[1,2-a]pyrazine;hydrobromide
InChIKeyBMTKBNISKGKYPI-UHFFFAOYSA-N
SMILESCC1=CN2C=C(N=CC2=N1)Br.Br

Computed by PubChem (NCBI)