CAS 2411637-60-8 is the registry number for 5-Bromo-6-methylimidazo(1,2-a)pyrazine hydrobromide, 98%. Offered by: AmBeed. Available pack sizes: 1g.
5-bromo-6-methylimidazo[1,2-a]pyrazine;hydrobromide (CAS 2411637-60-8) is a chemical compound with the molecular formula C7H7Br2N3 and a molecular weight of 292.96 g/mol. IUPAC name: 5-bromo-6-methylimidazo[1,2-a]pyrazine;hydrobromide. InChIKey: UCYWOMWQDHKMHB-UHFFFAOYSA-N.
| Molecular formula | C7H7Br2N3 |
|---|---|
| Molecular weight | 292.96 g/mol |
| IUPAC name | 5-bromo-6-methylimidazo[1,2-a]pyrazine;hydrobromide |
| InChIKey | UCYWOMWQDHKMHB-UHFFFAOYSA-N |
| SMILES | CC1=C(N2C=CN=C2C=N1)Br.Br |
Computed by PubChem (NCBI)