CAS 125066-69-5 appears in our catalog under these names: 6-(Methylsulfanyl)-1,2,3,4-tetrahydronaphthalen-1-one, 95%, 6-(Methylsulfanyl)-1,2,3,4-tetrahydronaphthalen-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 250mg, 2,5g.
6-methylsulfanyl-3,4-dihydro-2H-naphthalen-1-one (CAS 125066-69-5) is a chemical compound with the molecular formula C11H12OS and a molecular weight of 192.28 g/mol. IUPAC name: 6-methylsulfanyl-3,4-dihydro-2H-naphthalen-1-one. InChIKey: XPSKUTFYLZCTCZ-UHFFFAOYSA-N.
| Molecular formula | C11H12OS |
|---|---|
| Molecular weight | 192.28 g/mol |
| IUPAC name | 6-methylsulfanyl-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | XPSKUTFYLZCTCZ-UHFFFAOYSA-N |
| SMILES | CSC1=CC2=C(C=C1)C(=O)CCC2 |
Computed by PubChem (NCBI)