CAS 28035-02-1 is the registry number for 2,2-Dimethyl-3,4-dihydro-2H-1-benzothiopyran-4-one, 95%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
2,2-dimethyl-3H-thiochromen-4-one (CAS 28035-02-1) is a chemical compound with the molecular formula C11H12OS and a molecular weight of 192.28 g/mol. IUPAC name: 2,2-dimethyl-3H-thiochromen-4-one. InChIKey: FJMCSSKIPWJNLP-UHFFFAOYSA-N.
| Molecular formula | C11H12OS |
|---|---|
| Molecular weight | 192.28 g/mol |
| IUPAC name | 2,2-dimethyl-3H-thiochromen-4-one |
| InChIKey | FJMCSSKIPWJNLP-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)C2=CC=CC=C2S1)C |
Computed by PubChem (NCBI)