Products 91142-33-5

CAS 91142-33-5 is the registry number for S-(2,3-Dihydro-1H-inden-2-yl) ethanethioate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

S-(2,3-dihydro-1H-inden-2-yl) ethanethioate (CAS 91142-33-5) is a chemical compound with the molecular formula C11H12OS and a molecular weight of 192.28 g/mol. IUPAC name: S-(2,3-dihydro-1H-inden-2-yl) ethanethioate. InChIKey: XFOAYDJZGSCHFM-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12OS
Molecular weight192.28 g/mol
IUPAC nameS-(2,3-dihydro-1H-inden-2-yl) ethanethioate
InChIKeyXFOAYDJZGSCHFM-UHFFFAOYSA-N
SMILESCC(=O)SC1CC2=CC=CC=C2C1

Computed by PubChem (NCBI)