CAS 2259846-99-4 is the registry number for 1-(p-Tolylsulfinyl)bicyclo(1.1.0)butane, 98%. Offered by: AmBeed. Available pack sizes: 1g.
1-(4-methylphenyl)sulfinylbicyclo[1.1.0]butane (CAS 2259846-99-4) is a chemical compound with the molecular formula C11H12OS and a molecular weight of 192.28 g/mol. IUPAC name: 1-(4-methylphenyl)sulfinylbicyclo[1.1.0]butane. InChIKey: OMBDRQLEQLKFBL-UHFFFAOYSA-N.
| Molecular formula | C11H12OS |
|---|---|
| Molecular weight | 192.28 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfinylbicyclo[1.1.0]butane |
| InChIKey | OMBDRQLEQLKFBL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)C23CC2C3 |
Computed by PubChem (NCBI)