Products 125072-69-7
CAS 125072-69-7 is the registry number for Epinortrachelogenin. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 1 mg, 25 mg, 10 mg, 5 mg.
(3R,4S)-3-hydroxy-3,4-bis[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-2-one (CAS 125072-69-7) is a chemical compound with the molecular formula C20H22O7 and a molecular weight of 374.4 g/mol. IUPAC name: (3R,4S)-3-hydroxy-3,4-bis[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-2-one. InChIKey: ZITBJWXLODLDRH-VBKZILBWSA-N.
| Molecular formula | C20H22O7 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | (3R,4S)-3-hydroxy-3,4-bis[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-2-one |
| InChIKey | ZITBJWXLODLDRH-VBKZILBWSA-N |
| SMILES | COC1=C(C=CC(=C1)C[C@H]2COC(=O)[C@]2(CC3=CC(=C(C=C3)O)OC)O)O |
Computed by PubChem (NCBI)