CAS 125072-73-3 appears in our catalog under these names: (1R,2S)-2-Hydroxycyclopentane-1-carboxylic acid, 97%, (1R,2S)-2-Hydroxycyclopentanecarboxylic acid, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 10g, 100mg, 250mg, 500mg, 1g.
Cis-(1R,2S)-2-hydroxycyclopentane-1-carboxylic acid (CAS 125072-73-3) is a chemical compound with the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. IUPAC name: cis-(1R,2S)-2-hydroxycyclopentane-1-carboxylic acid. InChIKey: VCHGSWURBGPKQZ-UHNVWZDZSA-N.
| Molecular formula | C6H10O3 |
|---|---|
| Molecular weight | 130.14 g/mol |
| IUPAC name | cis-(1R,2S)-2-hydroxycyclopentane-1-carboxylic acid |
| InChIKey | VCHGSWURBGPKQZ-UHNVWZDZSA-N |
| SMILES | C1C[C@H]([C@H](C1)O)C(=O)O |
Computed by PubChem (NCBI)