CAS 169868-13-7 is the registry number for (1S,2R)-2-Hydroxycyclopentane-1-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
Cis-(1S,2R)-2-hydroxycyclopentane-1-carboxylic acid (CAS 169868-13-7) is a chemical compound with the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. IUPAC name: cis-(1S,2R)-2-hydroxycyclopentane-1-carboxylic acid. InChIKey: VCHGSWURBGPKQZ-CRCLSJGQSA-N.
| Molecular formula | C6H10O3 |
|---|---|
| Molecular weight | 130.14 g/mol |
| IUPAC name | cis-(1S,2R)-2-hydroxycyclopentane-1-carboxylic acid |
| InChIKey | VCHGSWURBGPKQZ-CRCLSJGQSA-N |
| SMILES | C1C[C@@H]([C@@H](C1)O)C(=O)O |
Computed by PubChem (NCBI)