Products 169868-13-7

CAS 169868-13-7 is the registry number for (1S,2R)-2-Hydroxycyclopentane-1-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Cis-(1S,2R)-2-hydroxycyclopentane-1-carboxylic acid (CAS 169868-13-7) is a chemical compound with the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. IUPAC name: cis-(1S,2R)-2-hydroxycyclopentane-1-carboxylic acid. InChIKey: VCHGSWURBGPKQZ-CRCLSJGQSA-N.

Identity
Molecular formulaC6H10O3
Molecular weight130.14 g/mol
IUPAC namecis-(1S,2R)-2-hydroxycyclopentane-1-carboxylic acid
InChIKeyVCHGSWURBGPKQZ-CRCLSJGQSA-N
SMILESC1C[C@@H]([C@@H](C1)O)C(=O)O

Computed by PubChem (NCBI)