Products 17502-28-2
CAS 17502-28-2 appears in our catalog under these names: Cis-2-hydroxycyclopentanecarboxylic acid, cis-2-Hydroxycyclopentanecarboxylic acid, 98+%, 2-Hydroxycyclopentane-1-carboxylic acid, 95%. Offered by: Biosynth, AmBeed, Combi-blocks. Available pack sizes: 50mg, 0,5g, 1g, 5g, 250mg, 100mg.
Cis-(1S,2R)-2-hydroxycyclopentane-1-carboxylic acid (CAS 17502-28-2) is a chemical compound with the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. IUPAC name: cis-(1S,2R)-2-hydroxycyclopentane-1-carboxylic acid. InChIKey: VCHGSWURBGPKQZ-CRCLSJGQSA-N.
| Molecular formula | C6H10O3 |
|---|---|
| Molecular weight | 130.14 g/mol |
| IUPAC name | cis-(1S,2R)-2-hydroxycyclopentane-1-carboxylic acid |
| InChIKey | VCHGSWURBGPKQZ-CRCLSJGQSA-N |
| SMILES | C1C[C@@H]([C@@H](C1)O)C(=O)O |
Computed by PubChem (NCBI)